C28H25F3N2O — CID 130343222
2,6,7-trimethyl-8-[5-(3,3,3-trifluoro-2,2-dimethylpropyl)quinolin-2-yl]-[1]benzofuro[2,3-b]pyridine (PubChem CID 130343222) has the molecular formula C28H25F3N2O and a molecular weight of 462.52 g/mol. Its IUPAC name is 2,6,7-trimethyl-8-[5-(3,3,3-trifluoro-2,2-dimethylpropyl)quinolin-2-yl]-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2,6,7-trimethyl-8-[5-(3,3,3-trifluoro-2,2-dimethylpropyl)quinolin-2-yl]-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 130343222 |
| Molecular Formula | C28H25F3N2O |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 2,6,7-trimethyl-8-[5-(3,3,3-trifluoro-2,2-dimethylpropyl)quinolin-2-yl]-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc2c(n1)oc1c(-c3ccc4c(CC(C)(C)C(F)(F)F)cccc4n3)c(C)c(C)cc12 |
| InChI | InChI=1S/C28H25F3N2O/c1-15-13-21-20-10-9-16(2)32-26(20)34-25(21)24(17(15)3)23-12-11-19-18(7-6-8-22(19)33-23)14-27(4,5)28(29,30)31/h6-13H,14H2,1-5H3 |
| InChIKey | AVWPVINVGJBNDZ-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |