C33H50N4O6S — CID 130343267
ethyl (2S,4R)-4-[[2-[(1R,3R)-1-acetyloxy-3-[[(2S,3S)-2-amino-3-methylpentanoyl]-methylamino]-4-methylpentyl]-1,3-thiazole-4-carbonyl]amino]-2-methyl-5-phenylpentanoate (PubChem CID 130343267) has the molecular formula C33H50N4O6S and a molecular weight of 630.85 g/mol. Its IUPAC name is ethyl (2S,4R)-4-[[2-[(1R,3R)-1-acetyloxy-3-[[(2S,3S)-2-amino-3-methylpentanoyl]-methylamino]-4-methylpentyl]-1,3-thiazole-4-carbonyl]amino]-2-methyl-5-phenylpentanoate.
| Compound Name | ethyl (2S,4R)-4-[[2-[(1R,3R)-1-acetyloxy-3-[[(2S,3S)-2-amino-3-methylpentanoyl]-methylamino]-4-methylpentyl]-1,3-thiazole-4-carbonyl]amino]-2-methyl-5-phenylpentanoate |
|---|---|
| PubChem CID | 130343267 |
| Molecular Formula | C33H50N4O6S |
| Molecular Weight | 630.85 g/mol |
| Exact Mass | 630.35 |
| IUPAC Name | ethyl (2S,4R)-4-[[2-[(1R,3R)-1-acetyloxy-3-[[(2S,3S)-2-amino-3-methylpentanoyl]-methylamino]-4-methylpentyl]-1,3-thiazole-4-carbonyl]amino]-2-methyl-5-phenylpentanoate |
| SMILES | CCOC(=O)[C@@H](C)C[C@H](Cc1ccccc1)NC(=O)c1csc([C@@H](C[C@H](C(C)C)N(C)C(=O)[C@@H](N)[C@@H](C)CC)OC(C)=O)n1 |
| InChI | InChI=1S/C33H50N4O6S/c1-9-21(5)29(34)32(40)37(8)27(20(3)4)18-28(43-23(7)38)31-36-26(19-44-31)30(39)35-25(16-22(6)33(41)42-10-2)17-24-14-12-11-13-15-24/h11-15,19-22,25,27-29H,9-10,16-18,34H2,1-8H3,(H,35,39)/t21-,22-,25+,27+,28+,29-/m0/s1 |
| InChIKey | UTGVDBAAVIFOPK-MGCZPNHGSA-N |
| XLogP | 4.92 |
| TPSA | 140.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.85 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |