About 1-(3,6-dimethyldibenzofuran-4-yl)-2,3-dimethyl-2H-imidazole
1-(3,6-dimethyldibenzofuran-4-yl)-2,3-dimethyl-2H-imidazole (PubChem CID 130343444) has the molecular formula C19H20N2O
and a molecular weight of 292.38 g/mol. Its IUPAC name is 1-(3,6-dimethyldibenzofuran-4-yl)-2,3-dimethyl-2H-imidazole.
Molecular Properties
| Compound Name | 1-(3,6-dimethyldibenzofuran-4-yl)-2,3-dimethyl-2H-imidazole |
| PubChem CID | 130343444 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 1-(3,6-dimethyldibenzofuran-4-yl)-2,3-dimethyl-2H-imidazole |
| SMILES | Cc1ccc2c(oc3c(C)cccc32)c1N1C=CN(C)C1C |
| InChI | InChI=1S/C19H20N2O/c1-12-8-9-16-15-7-5-6-13(2)18(15)22-19(16)17(12)21-11-10-20(4)14(21)3/h5-11,14H,1-4H3 |
| InChIKey | DNKJWKQOXHDPGB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3,6-dimethyldibenzofuran-4-yl)-2,3-dimethyl-2H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,6-dimethyldibenzofuran-4-yl)-2,3-dimethyl-2H-imidazole?
The IUPAC name of 1-(3,6-dimethyldibenzofuran-4-yl)-2,3-dimethyl-2H-imidazole (CID 130343444) is 1-(3,6-dimethyldibenzofuran-4-yl)-2,3-dimethyl-2H-imidazole.
What is the SMILES notation for 1-(3,6-dimethyldibenzofuran-4-yl)-2,3-dimethyl-2H-imidazole?
The canonical SMILES for 1-(3,6-dimethyldibenzofuran-4-yl)-2,3-dimethyl-2H-imidazole is Cc1ccc2c(oc3c(C)cccc32)c1N1C=CN(C)C1C.
What is the InChIKey of 1-(3,6-dimethyldibenzofuran-4-yl)-2,3-dimethyl-2H-imidazole?
The InChIKey is DNKJWKQOXHDPGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O/c1-12-8-9-16-15-7-5-6-13(2)18(15)22-19(16)17(12)21-11-10-20(4)14(21)3/h5-11,14H,1-4H3.
What are the key properties of 1-(3,6-dimethyldibenzofuran-4-yl)-2,3-dimethyl-2H-imidazole?
1-(3,6-dimethyldibenzofuran-4-yl)-2,3-dimethyl-2H-imidazole has a molecular weight of 292.38 g/mol, XLogP of 4.77, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,6-dimethyldibenzofuran-4-yl)-2,3-dimethyl-2H-imidazole is sourced from PubChem (CID 130343444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).