C29H25F10N — CID 130343571
4-(1,1,2,2,3,3,4,4,5,5-decafluorospiro[5.5]undecan-9-yl)-2-(2,3,5-trimethylphenyl)quinoline (PubChem CID 130343571) has the molecular formula C29H25F10N and a molecular weight of 577.51 g/mol. Its IUPAC name is 4-(1,1,2,2,3,3,4,4,5,5-decafluorospiro[5.5]undecan-9-yl)-2-(2,3,5-trimethylphenyl)quinoline.
| Compound Name | 4-(1,1,2,2,3,3,4,4,5,5-decafluorospiro[5.5]undecan-9-yl)-2-(2,3,5-trimethylphenyl)quinoline |
|---|---|
| PubChem CID | 130343571 |
| Molecular Formula | C29H25F10N |
| Molecular Weight | 577.51 g/mol |
| Exact Mass | 577.18 |
| IUPAC Name | 4-(1,1,2,2,3,3,4,4,5,5-decafluorospiro[5.5]undecan-9-yl)-2-(2,3,5-trimethylphenyl)quinoline |
| SMILES | Cc1cc(C)c(C)c(-c2cc(C3CCC4(CC3)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C4(F)F)c3ccccc3n2)c1 |
| InChI | InChI=1S/C29H25F10N/c1-15-12-16(2)17(3)20(13-15)23-14-21(19-6-4-5-7-22(19)40-23)18-8-10-24(11-9-18)25(30,31)27(34,35)29(38,39)28(36,37)26(24,32)33/h4-7,12-14,18H,8-11H2,1-3H3 |
| InChIKey | IPVXADZOUSZXPA-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.51 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|