C23H24F2N4O4 — CID 130343852
N-[3-[7-[1-(2,2-difluoroethyl)piperidin-4-yl]oxy-6-methoxyquinazolin-4-yl]oxyphenyl]formamide (PubChem CID 130343852) has the molecular formula C23H24F2N4O4 and a molecular weight of 458.47 g/mol. Its IUPAC name is N-[3-[7-[1-(2,2-difluoroethyl)piperidin-4-yl]oxy-6-methoxyquinazolin-4-yl]oxyphenyl]formamide.
| Compound Name | N-[3-[7-[1-(2,2-difluoroethyl)piperidin-4-yl]oxy-6-methoxyquinazolin-4-yl]oxyphenyl]formamide |
|---|---|
| PubChem CID | 130343852 |
| Molecular Formula | C23H24F2N4O4 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | N-[3-[7-[1-(2,2-difluoroethyl)piperidin-4-yl]oxy-6-methoxyquinazolin-4-yl]oxyphenyl]formamide |
| SMILES | COc1cc2c(Oc3cccc(NC=O)c3)ncnc2cc1OC1CCN(CC(F)F)CC1 |
| InChI | InChI=1S/C23H24F2N4O4/c1-31-20-10-18-19(11-21(20)32-16-5-7-29(8-6-16)12-22(24)25)26-13-27-23(18)33-17-4-2-3-15(9-17)28-14-30/h2-4,9-11,13-14,16,22H,5-8,12H2,1H3,(H,28,30) |
| InChIKey | VZLGPBZINOLOAL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|