C26H23F6N7O5 — CID 130344148
[(3aS,9S)-2,6-diamino-10,10-dihydroxy-4-[(3-oxo-1H-isoindol-2-yl)methyl]-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2,5-bis(trifluoromethyl)benzoate (PubChem CID 130344148) has the molecular formula C26H23F6N7O5 and a molecular weight of 627.50 g/mol. Its IUPAC name is [(3aS,9S)-2,6-diamino-10,10-dihydroxy-4-[(3-oxo-1H-isoindol-2-yl)methyl]-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2,5-bis(trifluoromethyl)benzoate.
| Compound Name | [(3aS,9S)-2,6-diamino-10,10-dihydroxy-4-[(3-oxo-1H-isoindol-2-yl)methyl]-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2,5-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 130344148 |
| Molecular Formula | C26H23F6N7O5 |
| Molecular Weight | 627.50 g/mol |
| Exact Mass | 627.17 |
| IUPAC Name | [(3aS,9S)-2,6-diamino-10,10-dihydroxy-4-[(3-oxo-1H-isoindol-2-yl)methyl]-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2,5-bis(trifluoromethyl)benzoate |
| SMILES | NC1=NC2C(CN3Cc4ccccc4C3=O)N=C(N)N3C[C@H](OC(=O)c4cc(C(F)(F)F)ccc4C(F)(F)F)C(O)(O)C23N1 |
| InChI | InChI=1S/C26H23F6N7O5/c27-25(28,29)12-5-6-15(26(30,31)32)14(7-12)20(41)44-17-10-39-22(34)35-16(18-23(39,24(17,42)43)37-21(33)36-18)9-38-8-11-3-1-2-4-13(11)19(38)40/h1-7,16-18,42-43H,8-10H2,(H2,34,35)(H3,33,36,37)/t16?,17-,18?,23?/m0/s1 |
| InChIKey | ZASBCZMFDOUWHG-KNGSWEPGSA-N |
| XLogP | 0.58 |
| TPSA | 179.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.50 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|