About (E)-2-fluoro-N'-[3-[5-methyl-2-(methyliminomethyl)-3-pyridinyl]prop-1-en-2-yl]but-2-enimidamide
(E)-2-fluoro-N'-[3-[5-methyl-2-(methyliminomethyl)-3-pyridinyl]prop-1-en-2-yl]but-2-enimidamide (PubChem CID 130344237) has the molecular formula C15H19FN4
and a molecular weight of 274.34 g/mol. Its IUPAC name is (E)-2-fluoro-N'-[3-[5-methyl-2-(methyliminomethyl)-3-pyridinyl]prop-1-en-2-yl]but-2-enimidamide.
Molecular Properties
| Compound Name | (E)-2-fluoro-N'-[3-[5-methyl-2-(methyliminomethyl)-3-pyridinyl]prop-1-en-2-yl]but-2-enimidamide |
| PubChem CID | 130344237 |
| Molecular Formula | C15H19FN4 |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (E)-2-fluoro-N'-[3-[5-methyl-2-(methyliminomethyl)-3-pyridinyl]prop-1-en-2-yl]but-2-enimidamide |
| SMILES | C=C(Cc1cc(C)cnc1/C=N/C)/N=C(N)/C(F)=C\C |
| InChI | InChI=1S/C15H19FN4/c1-5-13(16)15(17)20-11(3)7-12-6-10(2)8-19-14(12)9-18-4/h5-6,8-9H,3,7H2,1-2,4H3,(H2,17,20)/b13-5+,18-9+ |
| InChIKey | IXHIDHRDWLRKGA-RPYUPDBNSA-N |
| XLogP | 2.73 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-fluoro-N'-[3-[5-methyl-2-(methyliminomethyl)-3-pyridinyl]prop-1-en-2-yl]but-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-fluoro-N'-[3-[5-methyl-2-(methyliminomethyl)-3-pyridinyl]prop-1-en-2-yl]but-2-enimidamide?
The IUPAC name of (E)-2-fluoro-N'-[3-[5-methyl-2-(methyliminomethyl)-3-pyridinyl]prop-1-en-2-yl]but-2-enimidamide (CID 130344237) is (E)-2-fluoro-N'-[3-[5-methyl-2-(methyliminomethyl)-3-pyridinyl]prop-1-en-2-yl]but-2-enimidamide.
What is the SMILES notation for (E)-2-fluoro-N'-[3-[5-methyl-2-(methyliminomethyl)-3-pyridinyl]prop-1-en-2-yl]but-2-enimidamide?
The canonical SMILES for (E)-2-fluoro-N'-[3-[5-methyl-2-(methyliminomethyl)-3-pyridinyl]prop-1-en-2-yl]but-2-enimidamide is C=C(Cc1cc(C)cnc1/C=N/C)/N=C(N)/C(F)=C\C.
What is the InChIKey of (E)-2-fluoro-N'-[3-[5-methyl-2-(methyliminomethyl)-3-pyridinyl]prop-1-en-2-yl]but-2-enimidamide?
The InChIKey is IXHIDHRDWLRKGA-RPYUPDBNSA-N. The full InChI is InChI=1S/C15H19FN4/c1-5-13(16)15(17)20-11(3)7-12-6-10(2)8-19-14(12)9-18-4/h5-6,8-9H,3,7H2,1-2,4H3,(H2,17,20)/b13-5+,18-9+.
What are the key properties of (E)-2-fluoro-N'-[3-[5-methyl-2-(methyliminomethyl)-3-pyridinyl]prop-1-en-2-yl]but-2-enimidamide?
(E)-2-fluoro-N'-[3-[5-methyl-2-(methyliminomethyl)-3-pyridinyl]prop-1-en-2-yl]but-2-enimidamide has a molecular weight of 274.34 g/mol, XLogP of 2.73, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-fluoro-N'-[3-[5-methyl-2-(methyliminomethyl)-3-pyridinyl]prop-1-en-2-yl]but-2-enimidamide is sourced from PubChem (CID 130344237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).