C39H58N2O4S — CID 130344508
4-[(5aR)-3a-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethylamino]-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid (PubChem CID 130344508) has the molecular formula C39H58N2O4S and a molecular weight of 650.97 g/mol. Its IUPAC name is 4-[(5aR)-3a-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethylamino]-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid.
| Compound Name | 4-[(5aR)-3a-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethylamino]-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 130344508 |
| Molecular Formula | C39H58N2O4S |
| Molecular Weight | 650.97 g/mol |
| Exact Mass | 650.41 |
| IUPAC Name | 4-[(5aR)-3a-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethylamino]-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
| SMILES | CC1(C)C(c2ccc(C(=O)O)cc2)=CCC2(C)C1CCC1(C)C2CCC2C3CCCC3(NCCN3CCS(=O)(=O)CC3)CC[C@]21C |
| InChI | InChI=1S/C39H58N2O4S/c1-35(2)29(27-8-10-28(11-9-27)34(42)43)14-17-36(3)32(35)15-18-38(5)33(36)13-12-30-31-7-6-16-39(31,20-19-37(30,38)4)40-21-22-41-23-25-46(44,45)26-24-41/h8-11,14,30-33,40H,6-7,12-13,15-26H2,1-5H3,(H,42,43)/t30?,31?,32?,33?,36?,37-,38?,39?/m1/s1 |
| InChIKey | KJFICIKVQLDKRV-PUVWQEBLSA-N |
| XLogP | 7.31 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.97 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |