About 2-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide
2-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide (PubChem CID 130344791) has the molecular formula C6H12F3N3O2S
and a molecular weight of 247.24 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide.
Molecular Properties
| Compound Name | 2-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide |
| PubChem CID | 130344791 |
| Molecular Formula | C6H12F3N3O2S |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 2-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1CCNCC1CC(F)(F)F |
| InChI | InChI=1S/C6H12F3N3O2S/c7-6(8,9)3-5-4-11-1-2-12(5)15(10,13)14/h5,11H,1-4H2,(H2,10,13,14) |
| InChIKey | BURVLMXYYSQSFI-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide?
The IUPAC name of 2-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide (CID 130344791) is 2-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide.
What is the SMILES notation for 2-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide?
The canonical SMILES for 2-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide is NS(=O)(=O)N1CCNCC1CC(F)(F)F.
What is the InChIKey of 2-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide?
The InChIKey is BURVLMXYYSQSFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12F3N3O2S/c7-6(8,9)3-5-4-11-1-2-12(5)15(10,13)14/h5,11H,1-4H2,(H2,10,13,14).
What are the key properties of 2-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide?
2-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide has a molecular weight of 247.24 g/mol, XLogP of -0.58, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide is sourced from PubChem (CID 130344791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).