About [5-(benzenesulfonyl)-1,3-thiazol-2-yl]methanamine
[5-(benzenesulfonyl)-1,3-thiazol-2-yl]methanamine (PubChem CID 130345003) has the molecular formula C10H10N2O2S2
and a molecular weight of 254.34 g/mol. Its IUPAC name is [5-(benzenesulfonyl)-1,3-thiazol-2-yl]methanamine.
Molecular Properties
| Compound Name | [5-(benzenesulfonyl)-1,3-thiazol-2-yl]methanamine |
| PubChem CID | 130345003 |
| Molecular Formula | C10H10N2O2S2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | [5-(benzenesulfonyl)-1,3-thiazol-2-yl]methanamine |
| SMILES | NCc1ncc(S(=O)(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C10H10N2O2S2/c11-6-9-12-7-10(15-9)16(13,14)8-4-2-1-3-5-8/h1-5,7H,6,11H2 |
| InChIKey | MOUTWMBJLUKFLK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-(benzenesulfonyl)-1,3-thiazol-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(benzenesulfonyl)-1,3-thiazol-2-yl]methanamine?
The IUPAC name of [5-(benzenesulfonyl)-1,3-thiazol-2-yl]methanamine (CID 130345003) is [5-(benzenesulfonyl)-1,3-thiazol-2-yl]methanamine.
What is the SMILES notation for [5-(benzenesulfonyl)-1,3-thiazol-2-yl]methanamine?
The canonical SMILES for [5-(benzenesulfonyl)-1,3-thiazol-2-yl]methanamine is NCc1ncc(S(=O)(=O)c2ccccc2)s1.
What is the InChIKey of [5-(benzenesulfonyl)-1,3-thiazol-2-yl]methanamine?
The InChIKey is MOUTWMBJLUKFLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2S2/c11-6-9-12-7-10(15-9)16(13,14)8-4-2-1-3-5-8/h1-5,7H,6,11H2.
What are the key properties of [5-(benzenesulfonyl)-1,3-thiazol-2-yl]methanamine?
[5-(benzenesulfonyl)-1,3-thiazol-2-yl]methanamine has a molecular weight of 254.34 g/mol, XLogP of 1.43, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(benzenesulfonyl)-1,3-thiazol-2-yl]methanamine is sourced from PubChem (CID 130345003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).