About 2-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]ethanamine;hydrochloride
2-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]ethanamine;hydrochloride (PubChem CID 130345165) has the molecular formula C6H12ClN3O2S2
and a molecular weight of 257.77 g/mol. Its IUPAC name is 2-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]ethanamine;hydrochloride |
| PubChem CID | 130345165 |
| Molecular Formula | C6H12ClN3O2S2 |
| Molecular Weight | 257.77 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | 2-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]ethanamine;hydrochloride |
| SMILES | Cl.NCCS(=O)(=O)c1cnc(CN)s1 |
| InChI | InChI=1S/C6H11N3O2S2.ClH/c7-1-2-13(10,11)6-4-9-5(3-8)12-6;/h4H,1-3,7-8H2;1H |
| InChIKey | ZVRVORAWNGMZBQ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.77 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]ethanamine;hydrochloride?
The IUPAC name of 2-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]ethanamine;hydrochloride (CID 130345165) is 2-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]ethanamine;hydrochloride.
What is the SMILES notation for 2-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]ethanamine;hydrochloride?
The canonical SMILES for 2-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]ethanamine;hydrochloride is Cl.NCCS(=O)(=O)c1cnc(CN)s1.
What is the InChIKey of 2-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]ethanamine;hydrochloride?
The InChIKey is ZVRVORAWNGMZBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O2S2.ClH/c7-1-2-13(10,11)6-4-9-5(3-8)12-6;/h4H,1-3,7-8H2;1H.
What are the key properties of 2-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]ethanamine;hydrochloride?
2-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]ethanamine;hydrochloride has a molecular weight of 257.77 g/mol, XLogP of -0.24, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]ethanamine;hydrochloride is sourced from PubChem (CID 130345165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).