C19H21ClN2O2 — CID 130345441
4-[(6-chloro-4,4-dimethyl-2,3-dihydroquinolin-1-yl)methyl]-N-hydroxybenzamide (PubChem CID 130345441) has the molecular formula C19H21ClN2O2 and a molecular weight of 344.84 g/mol. Its IUPAC name is 4-[(6-chloro-4,4-dimethyl-2,3-dihydroquinolin-1-yl)methyl]-N-hydroxybenzamide.
| Compound Name | 4-[(6-chloro-4,4-dimethyl-2,3-dihydroquinolin-1-yl)methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 130345441 |
| Molecular Formula | C19H21ClN2O2 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 4-[(6-chloro-4,4-dimethyl-2,3-dihydroquinolin-1-yl)methyl]-N-hydroxybenzamide |
| SMILES | CC1(C)CCN(Cc2ccc(C(=O)NO)cc2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H21ClN2O2/c1-19(2)9-10-22(17-8-7-15(20)11-16(17)19)12-13-3-5-14(6-4-13)18(23)21-24/h3-8,11,24H,9-10,12H2,1-2H3,(H,21,23) |
| InChIKey | QHQCFPSGXOOKAL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|