C18H17N3OS — CID 130345543
4,13-dimethyl-5-(1-phenylethenyl)-8-oxa-3-thia-1,11,12-triazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene (PubChem CID 130345543) has the molecular formula C18H17N3OS and a molecular weight of 323.42 g/mol. Its IUPAC name is 4,13-dimethyl-5-(1-phenylethenyl)-8-oxa-3-thia-1,11,12-triazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene.
| Compound Name | 4,13-dimethyl-5-(1-phenylethenyl)-8-oxa-3-thia-1,11,12-triazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene |
|---|---|
| PubChem CID | 130345543 |
| Molecular Formula | C18H17N3OS |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 4,13-dimethyl-5-(1-phenylethenyl)-8-oxa-3-thia-1,11,12-triazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene |
| SMILES | C=C(c1ccccc1)c1c(C)sc2c1COCc1nnc(C)n1-2 |
| InChI | InChI=1S/C18H17N3OS/c1-11(14-7-5-4-6-8-14)17-12(2)23-18-15(17)9-22-10-16-20-19-13(3)21(16)18/h4-8H,1,9-10H2,2-3H3 |
| InChIKey | GBQMUZXHBVLLIV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |