C20H18FN3OS — CID 130345602
5-(6-fluoro-3,4-dihydronaphthalen-1-yl)-4,13-dimethyl-8-oxa-3-thia-1,11,12-triazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene (PubChem CID 130345602) has the molecular formula C20H18FN3OS and a molecular weight of 367.45 g/mol. Its IUPAC name is 5-(6-fluoro-3,4-dihydronaphthalen-1-yl)-4,13-dimethyl-8-oxa-3-thia-1,11,12-triazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene.
| Compound Name | 5-(6-fluoro-3,4-dihydronaphthalen-1-yl)-4,13-dimethyl-8-oxa-3-thia-1,11,12-triazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene |
|---|---|
| PubChem CID | 130345602 |
| Molecular Formula | C20H18FN3OS |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 5-(6-fluoro-3,4-dihydronaphthalen-1-yl)-4,13-dimethyl-8-oxa-3-thia-1,11,12-triazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene |
| SMILES | Cc1sc2c(c1C1=CCCc3cc(F)ccc31)COCc1nnc(C)n1-2 |
| InChI | InChI=1S/C20H18FN3OS/c1-11-19(16-5-3-4-13-8-14(21)6-7-15(13)16)17-9-25-10-18-23-22-12(2)24(18)20(17)26-11/h5-8H,3-4,9-10H2,1-2H3 |
| InChIKey | BKNUEFIETPVROC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |