C25H37N3O2 — CID 130345727
7-methoxy-N-(2-methylbutyl)-6-(3-pyrrolidin-1-ylpropoxy)-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine (PubChem CID 130345727) has the molecular formula C25H37N3O2 and a molecular weight of 411.59 g/mol. Its IUPAC name is 7-methoxy-N-(2-methylbutyl)-6-(3-pyrrolidin-1-ylpropoxy)-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine.
| Compound Name | 7-methoxy-N-(2-methylbutyl)-6-(3-pyrrolidin-1-ylpropoxy)-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine |
|---|---|
| PubChem CID | 130345727 |
| Molecular Formula | C25H37N3O2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.29 |
| IUPAC Name | 7-methoxy-N-(2-methylbutyl)-6-(3-pyrrolidin-1-ylpropoxy)-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine |
| SMILES | CCC(C)CNc1c2c(nc3cc(OCCCN4CCCC4)c(OC)cc13)CCC2 |
| InChI | InChI=1S/C25H37N3O2/c1-4-18(2)17-26-25-19-9-7-10-21(19)27-22-16-24(23(29-3)15-20(22)25)30-14-8-13-28-11-5-6-12-28/h15-16,18H,4-14,17H2,1-3H3,(H,26,27) |
| InChIKey | DYFSCDFGOHQCMP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|