C19H22F3N3O5S — CID 130346019
propan-2-yl 12,14,14-trimethyl-5-(trifluoromethylsulfonyloxy)-6,8,12-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5,10-pentaene-10-carboxylate (PubChem CID 130346019) has the molecular formula C19H22F3N3O5S and a molecular weight of 461.46 g/mol. Its IUPAC name is propan-2-yl 12,14,14-trimethyl-5-(trifluoromethylsulfonyloxy)-6,8,12-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5,10-pentaene-10-carboxylate.
| Compound Name | propan-2-yl 12,14,14-trimethyl-5-(trifluoromethylsulfonyloxy)-6,8,12-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5,10-pentaene-10-carboxylate |
|---|---|
| PubChem CID | 130346019 |
| Molecular Formula | C19H22F3N3O5S |
| Molecular Weight | 461.46 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | propan-2-yl 12,14,14-trimethyl-5-(trifluoromethylsulfonyloxy)-6,8,12-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5,10-pentaene-10-carboxylate |
| SMILES | CC(C)OC(=O)C1=CN(C)CC(C)(C)c2c1[nH]c1nc(OS(=O)(=O)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C19H22F3N3O5S/c1-10(2)29-17(26)12-8-25(5)9-18(3,4)14-11-6-7-13(23-16(11)24-15(12)14)30-31(27,28)19(20,21)22/h6-8,10H,9H2,1-5H3,(H,23,24) |
| InChIKey | VWSUWKQJNJXZCC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 101.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|