About 5-methyl-2-(2-methylprop-2-enoxy)-4-oxatricyclo[4.2.1.03,7]nonan-5-ol
5-methyl-2-(2-methylprop-2-enoxy)-4-oxatricyclo[4.2.1.03,7]nonan-5-ol (PubChem CID 130346313) has the molecular formula C13H20O3
and a molecular weight of 224.30 g/mol. Its IUPAC name is 5-methyl-2-(2-methylprop-2-enoxy)-4-oxatricyclo[4.2.1.03,7]nonan-5-ol.
Molecular Properties
| Compound Name | 5-methyl-2-(2-methylprop-2-enoxy)-4-oxatricyclo[4.2.1.03,7]nonan-5-ol |
| PubChem CID | 130346313 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 5-methyl-2-(2-methylprop-2-enoxy)-4-oxatricyclo[4.2.1.03,7]nonan-5-ol |
| SMILES | C=C(C)COC1C2CC3C1OC(C)(O)C3C2 |
| InChI | InChI=1S/C13H20O3/c1-7(2)6-15-11-8-4-9-10(5-8)13(3,14)16-12(9)11/h8-12,14H,1,4-6H2,2-3H3 |
| InChIKey | KYIRKWGAVBXHHQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-(2-methylprop-2-enoxy)-4-oxatricyclo[4.2.1.03,7]nonan-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-(2-methylprop-2-enoxy)-4-oxatricyclo[4.2.1.03,7]nonan-5-ol?
The IUPAC name of 5-methyl-2-(2-methylprop-2-enoxy)-4-oxatricyclo[4.2.1.03,7]nonan-5-ol (CID 130346313) is 5-methyl-2-(2-methylprop-2-enoxy)-4-oxatricyclo[4.2.1.03,7]nonan-5-ol.
What is the SMILES notation for 5-methyl-2-(2-methylprop-2-enoxy)-4-oxatricyclo[4.2.1.03,7]nonan-5-ol?
The canonical SMILES for 5-methyl-2-(2-methylprop-2-enoxy)-4-oxatricyclo[4.2.1.03,7]nonan-5-ol is C=C(C)COC1C2CC3C1OC(C)(O)C3C2.
What is the InChIKey of 5-methyl-2-(2-methylprop-2-enoxy)-4-oxatricyclo[4.2.1.03,7]nonan-5-ol?
The InChIKey is KYIRKWGAVBXHHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O3/c1-7(2)6-15-11-8-4-9-10(5-8)13(3,14)16-12(9)11/h8-12,14H,1,4-6H2,2-3H3.
What are the key properties of 5-methyl-2-(2-methylprop-2-enoxy)-4-oxatricyclo[4.2.1.03,7]nonan-5-ol?
5-methyl-2-(2-methylprop-2-enoxy)-4-oxatricyclo[4.2.1.03,7]nonan-5-ol has a molecular weight of 224.30 g/mol, XLogP of 1.71, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-(2-methylprop-2-enoxy)-4-oxatricyclo[4.2.1.03,7]nonan-5-ol is sourced from PubChem (CID 130346313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).