C19H36N2O5 — CID 130346361
2-methoxyethyl N-[[5-(butan-2-yloxycarbonylamino)-1,3,3-trimethylcyclohexyl]methyl]carbamate (PubChem CID 130346361) has the molecular formula C19H36N2O5 and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-methoxyethyl N-[[5-(butan-2-yloxycarbonylamino)-1,3,3-trimethylcyclohexyl]methyl]carbamate.
| Compound Name | 2-methoxyethyl N-[[5-(butan-2-yloxycarbonylamino)-1,3,3-trimethylcyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 130346361 |
| Molecular Formula | C19H36N2O5 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 2-methoxyethyl N-[[5-(butan-2-yloxycarbonylamino)-1,3,3-trimethylcyclohexyl]methyl]carbamate |
| SMILES | CCC(C)OC(=O)NC1CC(C)(C)CC(C)(CNC(=O)OCCOC)C1 |
| InChI | InChI=1S/C19H36N2O5/c1-7-14(2)26-17(23)21-15-10-18(3,4)12-19(5,11-15)13-20-16(22)25-9-8-24-6/h14-15H,7-13H2,1-6H3,(H,20,22)(H,21,23) |
| InChIKey | UOXFVCQJNIZQEC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|