About N-[(Z,3E)-3-ethylidene-4-hexyl-4-methyldec-1-enyl]methanimine
N-[(Z,3E)-3-ethylidene-4-hexyl-4-methyldec-1-enyl]methanimine (PubChem CID 130346396) has the molecular formula C20H37N
and a molecular weight of 291.52 g/mol. Its IUPAC name is N-[(Z,3E)-3-ethylidene-4-hexyl-4-methyldec-1-enyl]methanimine.
Molecular Properties
| Compound Name | N-[(Z,3E)-3-ethylidene-4-hexyl-4-methyldec-1-enyl]methanimine |
| PubChem CID | 130346396 |
| Molecular Formula | C20H37N |
| Molecular Weight | 291.52 g/mol |
| Exact Mass | 291.29 |
| IUPAC Name | N-[(Z,3E)-3-ethylidene-4-hexyl-4-methyldec-1-enyl]methanimine |
| SMILES | C=N/C=C\C(=C/C)C(C)(CCCCCC)CCCCCC |
| InChI | InChI=1S/C20H37N/c1-6-9-11-13-16-20(4,17-14-12-10-7-2)19(8-3)15-18-21-5/h8,15,18H,5-7,9-14,16-17H2,1-4H3/b18-15-,19-8+ |
| InChIKey | WBHBMGFVGAINNP-HPDKGKPWSA-N |
| XLogP | 7.09 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.52 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z,3E)-3-ethylidene-4-hexyl-4-methyldec-1-enyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z,3E)-3-ethylidene-4-hexyl-4-methyldec-1-enyl]methanimine?
The IUPAC name of N-[(Z,3E)-3-ethylidene-4-hexyl-4-methyldec-1-enyl]methanimine (CID 130346396) is N-[(Z,3E)-3-ethylidene-4-hexyl-4-methyldec-1-enyl]methanimine.
What is the SMILES notation for N-[(Z,3E)-3-ethylidene-4-hexyl-4-methyldec-1-enyl]methanimine?
The canonical SMILES for N-[(Z,3E)-3-ethylidene-4-hexyl-4-methyldec-1-enyl]methanimine is C=N/C=C\C(=C/C)C(C)(CCCCCC)CCCCCC.
What is the InChIKey of N-[(Z,3E)-3-ethylidene-4-hexyl-4-methyldec-1-enyl]methanimine?
The InChIKey is WBHBMGFVGAINNP-HPDKGKPWSA-N. The full InChI is InChI=1S/C20H37N/c1-6-9-11-13-16-20(4,17-14-12-10-7-2)19(8-3)15-18-21-5/h8,15,18H,5-7,9-14,16-17H2,1-4H3/b18-15-,19-8+.
What are the key properties of N-[(Z,3E)-3-ethylidene-4-hexyl-4-methyldec-1-enyl]methanimine?
N-[(Z,3E)-3-ethylidene-4-hexyl-4-methyldec-1-enyl]methanimine has a molecular weight of 291.52 g/mol, XLogP of 7.09, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z,3E)-3-ethylidene-4-hexyl-4-methyldec-1-enyl]methanimine is sourced from PubChem (CID 130346396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).