C26H28F3N3O4S3 — CID 130346633
N-[2,4-bis[(Z)-(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-3-hydroxycyclobutyl]-1,1,1-trifluoro-N-methoxymethanesulfonamide (PubChem CID 130346633) has the molecular formula C26H28F3N3O4S3 and a molecular weight of 599.72 g/mol. Its IUPAC name is N-[2,4-bis[(Z)-(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-3-hydroxycyclobutyl]-1,1,1-trifluoro-N-methoxymethanesulfonamide.
| Compound Name | N-[2,4-bis[(Z)-(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-3-hydroxycyclobutyl]-1,1,1-trifluoro-N-methoxymethanesulfonamide |
|---|---|
| PubChem CID | 130346633 |
| Molecular Formula | C26H28F3N3O4S3 |
| Molecular Weight | 599.72 g/mol |
| Exact Mass | 599.12 |
| IUPAC Name | N-[2,4-bis[(Z)-(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-3-hydroxycyclobutyl]-1,1,1-trifluoro-N-methoxymethanesulfonamide |
| SMILES | CCN1/C(=C/C2C(O)C(/C=C3\Sc4ccccc4N3CC)C2N(OC)S(=O)(=O)C(F)(F)F)Sc2ccccc21 |
| InChI | InChI=1S/C26H28F3N3O4S3/c1-4-30-18-10-6-8-12-20(18)37-22(30)14-16-24(32(36-3)39(34,35)26(27,28)29)17(25(16)33)15-23-31(5-2)19-11-7-9-13-21(19)38-23/h6-17,24-25,33H,4-5H2,1-3H3/b22-14-,23-15- |
| InChIKey | UTTRXGQXDUTXGM-VMTNTFKOSA-N |
| XLogP | 5.62 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.72 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|