About ethyl (E)-3-[4-[2-[(2,6-difluorobenzoyl)amino]-2-methylpropanoyl]phenyl]-2-methylprop-2-enoate
ethyl (E)-3-[4-[2-[(2,6-difluorobenzoyl)amino]-2-methylpropanoyl]phenyl]-2-methylprop-2-enoate (PubChem CID 130347026) has the molecular formula C23H23F2NO4
and a molecular weight of 415.44 g/mol. Its IUPAC name is ethyl (E)-3-[4-[2-[(2,6-difluorobenzoyl)amino]-2-methylpropanoyl]phenyl]-2-methylprop-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-3-[4-[2-[(2,6-difluorobenzoyl)amino]-2-methylpropanoyl]phenyl]-2-methylprop-2-enoate |
| PubChem CID | 130347026 |
| Molecular Formula | C23H23F2NO4 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | ethyl (E)-3-[4-[2-[(2,6-difluorobenzoyl)amino]-2-methylpropanoyl]phenyl]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/c1ccc(C(=O)C(C)(C)NC(=O)c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C23H23F2NO4/c1-5-30-22(29)14(2)13-15-9-11-16(12-10-15)20(27)23(3,4)26-21(28)19-17(24)7-6-8-18(19)25/h6-13H,5H2,1-4H3,(H,26,28)/b14-13+ |
| InChIKey | WDEAVHNGCHSRSC-BUHFOSPRSA-N |
| XLogP | 4.32 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-3-[4-[2-[(2,6-difluorobenzoyl)amino]-2-methylpropanoyl]phenyl]-2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-3-[4-[2-[(2,6-difluorobenzoyl)amino]-2-methylpropanoyl]phenyl]-2-methylprop-2-enoate?
The IUPAC name of ethyl (E)-3-[4-[2-[(2,6-difluorobenzoyl)amino]-2-methylpropanoyl]phenyl]-2-methylprop-2-enoate (CID 130347026) is ethyl (E)-3-[4-[2-[(2,6-difluorobenzoyl)amino]-2-methylpropanoyl]phenyl]-2-methylprop-2-enoate.
What is the SMILES notation for ethyl (E)-3-[4-[2-[(2,6-difluorobenzoyl)amino]-2-methylpropanoyl]phenyl]-2-methylprop-2-enoate?
The canonical SMILES for ethyl (E)-3-[4-[2-[(2,6-difluorobenzoyl)amino]-2-methylpropanoyl]phenyl]-2-methylprop-2-enoate is CCOC(=O)/C(C)=C/c1ccc(C(=O)C(C)(C)NC(=O)c2c(F)cccc2F)cc1.
What is the InChIKey of ethyl (E)-3-[4-[2-[(2,6-difluorobenzoyl)amino]-2-methylpropanoyl]phenyl]-2-methylprop-2-enoate?
The InChIKey is WDEAVHNGCHSRSC-BUHFOSPRSA-N. The full InChI is InChI=1S/C23H23F2NO4/c1-5-30-22(29)14(2)13-15-9-11-16(12-10-15)20(27)23(3,4)26-21(28)19-17(24)7-6-8-18(19)25/h6-13H,5H2,1-4H3,(H,26,28)/b14-13+.
What are the key properties of ethyl (E)-3-[4-[2-[(2,6-difluorobenzoyl)amino]-2-methylpropanoyl]phenyl]-2-methylprop-2-enoate?
ethyl (E)-3-[4-[2-[(2,6-difluorobenzoyl)amino]-2-methylpropanoyl]phenyl]-2-methylprop-2-enoate has a molecular weight of 415.44 g/mol, XLogP of 4.32, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-3-[4-[2-[(2,6-difluorobenzoyl)amino]-2-methylpropanoyl]phenyl]-2-methylprop-2-enoate is sourced from PubChem (CID 130347026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).