C34H60N4O8 — CID 130347314
1,3-bis(7-hydroxy-3,11-dioxa-7-azadispiro[5.1.58.36]hexadecan-15-yl)-1-(1-propoxybutan-2-yl)urea (PubChem CID 130347314) has the molecular formula C34H60N4O8 and a molecular weight of 652.87 g/mol. Its IUPAC name is 1,3-bis(7-hydroxy-3,11-dioxa-7-azadispiro[5.1.58.36]hexadecan-15-yl)-1-(1-propoxybutan-2-yl)urea.
| Compound Name | 1,3-bis(7-hydroxy-3,11-dioxa-7-azadispiro[5.1.58.36]hexadecan-15-yl)-1-(1-propoxybutan-2-yl)urea |
|---|---|
| PubChem CID | 130347314 |
| Molecular Formula | C34H60N4O8 |
| Molecular Weight | 652.87 g/mol |
| Exact Mass | 652.44 |
| IUPAC Name | 1,3-bis(7-hydroxy-3,11-dioxa-7-azadispiro[5.1.58.36]hexadecan-15-yl)-1-(1-propoxybutan-2-yl)urea |
| SMILES | CCCOCC(CC)N(C(=O)NC1CC2(CCOCC2)N(O)C2(CCOCC2)C1)C1CC2(CCOCC2)N(O)C2(CCOCC2)C1 |
| InChI | InChI=1S/C34H60N4O8/c1-3-13-46-26-28(4-2)36(29-24-33(9-18-44-19-10-33)38(41)34(25-29)11-20-45-21-12-34)30(39)35-27-22-31(5-14-42-15-6-31)37(40)32(23-27)7-16-43-17-8-32/h27-29,40-41H,3-26H2,1-2H3,(H,35,39) |
| InChIKey | WXSHFOCJVBEVKK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.87 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|