About 1-N'-[(E)-4-(oxan-4-yl)but-3-enyl]-1-N'-propylprop-2-ene-1,1-diamine
1-N'-[(E)-4-(oxan-4-yl)but-3-enyl]-1-N'-propylprop-2-ene-1,1-diamine (PubChem CID 130348446) has the molecular formula C15H28N2O
and a molecular weight of 252.40 g/mol. Its IUPAC name is 1-N'-[(E)-4-(oxan-4-yl)but-3-enyl]-1-N'-propylprop-2-ene-1,1-diamine.
Molecular Properties
| Compound Name | 1-N'-[(E)-4-(oxan-4-yl)but-3-enyl]-1-N'-propylprop-2-ene-1,1-diamine |
| PubChem CID | 130348446 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 1-N'-[(E)-4-(oxan-4-yl)but-3-enyl]-1-N'-propylprop-2-ene-1,1-diamine |
| SMILES | C=CC(N)N(CCC)CC/C=C/C1CCOCC1 |
| InChI | InChI=1S/C15H28N2O/c1-3-10-17(15(16)4-2)11-6-5-7-14-8-12-18-13-9-14/h4-5,7,14-15H,2-3,6,8-13,16H2,1H3/b7-5+ |
| InChIKey | PLIGVWQTLKSJQV-FNORWQNLSA-N |
| XLogP | 2.54 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-N'-[(E)-4-(oxan-4-yl)but-3-enyl]-1-N'-propylprop-2-ene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N'-[(E)-4-(oxan-4-yl)but-3-enyl]-1-N'-propylprop-2-ene-1,1-diamine?
The IUPAC name of 1-N'-[(E)-4-(oxan-4-yl)but-3-enyl]-1-N'-propylprop-2-ene-1,1-diamine (CID 130348446) is 1-N'-[(E)-4-(oxan-4-yl)but-3-enyl]-1-N'-propylprop-2-ene-1,1-diamine.
What is the SMILES notation for 1-N'-[(E)-4-(oxan-4-yl)but-3-enyl]-1-N'-propylprop-2-ene-1,1-diamine?
The canonical SMILES for 1-N'-[(E)-4-(oxan-4-yl)but-3-enyl]-1-N'-propylprop-2-ene-1,1-diamine is C=CC(N)N(CCC)CC/C=C/C1CCOCC1.
What is the InChIKey of 1-N'-[(E)-4-(oxan-4-yl)but-3-enyl]-1-N'-propylprop-2-ene-1,1-diamine?
The InChIKey is PLIGVWQTLKSJQV-FNORWQNLSA-N. The full InChI is InChI=1S/C15H28N2O/c1-3-10-17(15(16)4-2)11-6-5-7-14-8-12-18-13-9-14/h4-5,7,14-15H,2-3,6,8-13,16H2,1H3/b7-5+.
What are the key properties of 1-N'-[(E)-4-(oxan-4-yl)but-3-enyl]-1-N'-propylprop-2-ene-1,1-diamine?
1-N'-[(E)-4-(oxan-4-yl)but-3-enyl]-1-N'-propylprop-2-ene-1,1-diamine has a molecular weight of 252.40 g/mol, XLogP of 2.54, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N'-[(E)-4-(oxan-4-yl)but-3-enyl]-1-N'-propylprop-2-ene-1,1-diamine is sourced from PubChem (CID 130348446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).