About 2-ethyl-3,4,5-trimethyl-6-[3-[(Z)-prop-1-enoxy]pentan-2-yloxy]oxane
2-ethyl-3,4,5-trimethyl-6-[3-[(Z)-prop-1-enoxy]pentan-2-yloxy]oxane (PubChem CID 130348635) has the molecular formula C18H34O3
and a molecular weight of 298.47 g/mol. Its IUPAC name is 2-ethyl-3,4,5-trimethyl-6-[3-[(Z)-prop-1-enoxy]pentan-2-yloxy]oxane.
Molecular Properties
| Compound Name | 2-ethyl-3,4,5-trimethyl-6-[3-[(Z)-prop-1-enoxy]pentan-2-yloxy]oxane |
| PubChem CID | 130348635 |
| Molecular Formula | C18H34O3 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | 2-ethyl-3,4,5-trimethyl-6-[3-[(Z)-prop-1-enoxy]pentan-2-yloxy]oxane |
| SMILES | C/C=C\OC(CC)C(C)OC1OC(CC)C(C)C(C)C1C |
| InChI | InChI=1S/C18H34O3/c1-8-11-19-17(10-3)15(7)20-18-14(6)12(4)13(5)16(9-2)21-18/h8,11-18H,9-10H2,1-7H3/b11-8- |
| InChIKey | OKXVQAXYHTVMBO-FLIBITNWSA-N |
| XLogP | 4.76 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-3,4,5-trimethyl-6-[3-[(Z)-prop-1-enoxy]pentan-2-yloxy]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3,4,5-trimethyl-6-[3-[(Z)-prop-1-enoxy]pentan-2-yloxy]oxane?
The IUPAC name of 2-ethyl-3,4,5-trimethyl-6-[3-[(Z)-prop-1-enoxy]pentan-2-yloxy]oxane (CID 130348635) is 2-ethyl-3,4,5-trimethyl-6-[3-[(Z)-prop-1-enoxy]pentan-2-yloxy]oxane.
What is the SMILES notation for 2-ethyl-3,4,5-trimethyl-6-[3-[(Z)-prop-1-enoxy]pentan-2-yloxy]oxane?
The canonical SMILES for 2-ethyl-3,4,5-trimethyl-6-[3-[(Z)-prop-1-enoxy]pentan-2-yloxy]oxane is C/C=C\OC(CC)C(C)OC1OC(CC)C(C)C(C)C1C.
What is the InChIKey of 2-ethyl-3,4,5-trimethyl-6-[3-[(Z)-prop-1-enoxy]pentan-2-yloxy]oxane?
The InChIKey is OKXVQAXYHTVMBO-FLIBITNWSA-N. The full InChI is InChI=1S/C18H34O3/c1-8-11-19-17(10-3)15(7)20-18-14(6)12(4)13(5)16(9-2)21-18/h8,11-18H,9-10H2,1-7H3/b11-8-.
What are the key properties of 2-ethyl-3,4,5-trimethyl-6-[3-[(Z)-prop-1-enoxy]pentan-2-yloxy]oxane?
2-ethyl-3,4,5-trimethyl-6-[3-[(Z)-prop-1-enoxy]pentan-2-yloxy]oxane has a molecular weight of 298.47 g/mol, XLogP of 4.76, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3,4,5-trimethyl-6-[3-[(Z)-prop-1-enoxy]pentan-2-yloxy]oxane is sourced from PubChem (CID 130348635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).