C15H16F3N3O2S2 — CID 130348665
5-cyclopropyl-2-(1,3-thiazol-2-yl)-N-(5,5,5-trifluoro-4-oxopentyl)-4,5-dihydro-1,3-thiazole-4-carboxamide (PubChem CID 130348665) has the molecular formula C15H16F3N3O2S2 and a molecular weight of 391.44 g/mol. Its IUPAC name is 5-cyclopropyl-2-(1,3-thiazol-2-yl)-N-(5,5,5-trifluoro-4-oxopentyl)-4,5-dihydro-1,3-thiazole-4-carboxamide.
| Compound Name | 5-cyclopropyl-2-(1,3-thiazol-2-yl)-N-(5,5,5-trifluoro-4-oxopentyl)-4,5-dihydro-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 130348665 |
| Molecular Formula | C15H16F3N3O2S2 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 5-cyclopropyl-2-(1,3-thiazol-2-yl)-N-(5,5,5-trifluoro-4-oxopentyl)-4,5-dihydro-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCCCC(=O)C(F)(F)F)C1N=C(c2nccs2)SC1C1CC1 |
| InChI | InChI=1S/C15H16F3N3O2S2/c16-15(17,18)9(22)2-1-5-19-12(23)10-11(8-3-4-8)25-14(21-10)13-20-6-7-24-13/h6-8,10-11H,1-5H2,(H,19,23) |
| InChIKey | KBPPSDDJVHGHMM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|