C33H31N5O3S — CID 130348754
[3-[4-amino-5-(2-phenylquinolin-7-yl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclobutyl]methyl 4-methylcyclohexa-1,3-diene-1-sulfonate (PubChem CID 130348754) has the molecular formula C33H31N5O3S and a molecular weight of 577.71 g/mol. Its IUPAC name is [3-[4-amino-5-(2-phenylquinolin-7-yl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclobutyl]methyl 4-methylcyclohexa-1,3-diene-1-sulfonate.
| Compound Name | [3-[4-amino-5-(2-phenylquinolin-7-yl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclobutyl]methyl 4-methylcyclohexa-1,3-diene-1-sulfonate |
|---|---|
| PubChem CID | 130348754 |
| Molecular Formula | C33H31N5O3S |
| Molecular Weight | 577.71 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | [3-[4-amino-5-(2-phenylquinolin-7-yl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclobutyl]methyl 4-methylcyclohexa-1,3-diene-1-sulfonate |
| SMILES | CC1=CC=C(S(=O)(=O)OCC2CC(n3cc(-c4ccc5ccc(-c6ccccc6)nc5c4)c4c(N)ncnc43)C2)CC1 |
| InChI | InChI=1S/C33H31N5O3S/c1-21-7-12-27(13-8-21)42(39,40)41-19-22-15-26(16-22)38-18-28(31-32(34)35-20-36-33(31)38)25-10-9-24-11-14-29(37-30(24)17-25)23-5-3-2-4-6-23/h2-7,9-12,14,17-18,20,22,26H,8,13,15-16,19H2,1H3,(H2,34,35,36) |
| InChIKey | UAEOJOVVUJJAAS-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.71 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|