C31H33ClN6 — CID 130348840
7-[8-chloro-7-methyl-3-[3-(4-methylpiperazin-1-yl)cyclobutyl]-8H-imidazo[1,5-a]pyrazin-1-yl]-2-phenylquinoline (PubChem CID 130348840) has the molecular formula C31H33ClN6 and a molecular weight of 525.10 g/mol. Its IUPAC name is 7-[8-chloro-7-methyl-3-[3-(4-methylpiperazin-1-yl)cyclobutyl]-8H-imidazo[1,5-a]pyrazin-1-yl]-2-phenylquinoline.
| Compound Name | 7-[8-chloro-7-methyl-3-[3-(4-methylpiperazin-1-yl)cyclobutyl]-8H-imidazo[1,5-a]pyrazin-1-yl]-2-phenylquinoline |
|---|---|
| PubChem CID | 130348840 |
| Molecular Formula | C31H33ClN6 |
| Molecular Weight | 525.10 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | 7-[8-chloro-7-methyl-3-[3-(4-methylpiperazin-1-yl)cyclobutyl]-8H-imidazo[1,5-a]pyrazin-1-yl]-2-phenylquinoline |
| SMILES | CN1CCN(C2CC(c3nc(-c4ccc5ccc(-c6ccccc6)nc5c4)c4n3C=CN(C)C4Cl)C2)CC1 |
| InChI | InChI=1S/C31H33ClN6/c1-35-12-15-37(16-13-35)25-18-24(19-25)31-34-28(29-30(32)36(2)14-17-38(29)31)23-9-8-22-10-11-26(33-27(22)20-23)21-6-4-3-5-7-21/h3-11,14,17,20,24-25,30H,12-13,15-16,18-19H2,1-2H3 |
| InChIKey | YDKJRTDVEBCMGX-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 40.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.10 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|