C7H7F2NO2S — CID 130348869
(3,5-difluoro-4-pyridinyl)methyl methanesulfinate (PubChem CID 130348869) has the molecular formula C7H7F2NO2S and a molecular weight of 207.20 g/mol. Its IUPAC name is (3,5-difluoro-4-pyridinyl)methyl methanesulfinate.
| Compound Name | (3,5-difluoro-4-pyridinyl)methyl methanesulfinate |
|---|---|
| PubChem CID | 130348869 |
| Molecular Formula | C7H7F2NO2S |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | (3,5-difluoro-4-pyridinyl)methyl methanesulfinate |
| SMILES | CS(=O)OCc1c(F)cncc1F |
| InChI | InChI=1S/C7H7F2NO2S/c1-13(11)12-4-5-6(8)2-10-3-7(5)9/h2-3H,4H2,1H3 |
| InChIKey | WCZOBIAJOPWUMH-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |