About 1-[(3,5-difluoro-4-pyridinyl)methyl]-5-fluoro-3-methylpyrazolo[5,4-b]pyridine
1-[(3,5-difluoro-4-pyridinyl)methyl]-5-fluoro-3-methylpyrazolo[5,4-b]pyridine (PubChem CID 130348871) has the molecular formula C13H9F3N4
and a molecular weight of 278.24 g/mol. Its IUPAC name is 1-[(3,5-difluoro-4-pyridinyl)methyl]-5-fluoro-3-methylpyrazolo[5,4-b]pyridine.
Molecular Properties
| Compound Name | 1-[(3,5-difluoro-4-pyridinyl)methyl]-5-fluoro-3-methylpyrazolo[5,4-b]pyridine |
| PubChem CID | 130348871 |
| Molecular Formula | C13H9F3N4 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 1-[(3,5-difluoro-4-pyridinyl)methyl]-5-fluoro-3-methylpyrazolo[5,4-b]pyridine |
| SMILES | Cc1nn(Cc2c(F)cncc2F)c2ncc(F)cc12 |
| InChI | InChI=1S/C13H9F3N4/c1-7-9-2-8(14)3-18-13(9)20(19-7)6-10-11(15)4-17-5-12(10)16/h2-5H,6H2,1H3 |
| InChIKey | ZJCVGOTWZUXVIQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(3,5-difluoro-4-pyridinyl)methyl]-5-fluoro-3-methylpyrazolo[5,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-difluoro-4-pyridinyl)methyl]-5-fluoro-3-methylpyrazolo[5,4-b]pyridine?
The IUPAC name of 1-[(3,5-difluoro-4-pyridinyl)methyl]-5-fluoro-3-methylpyrazolo[5,4-b]pyridine (CID 130348871) is 1-[(3,5-difluoro-4-pyridinyl)methyl]-5-fluoro-3-methylpyrazolo[5,4-b]pyridine.
What is the SMILES notation for 1-[(3,5-difluoro-4-pyridinyl)methyl]-5-fluoro-3-methylpyrazolo[5,4-b]pyridine?
The canonical SMILES for 1-[(3,5-difluoro-4-pyridinyl)methyl]-5-fluoro-3-methylpyrazolo[5,4-b]pyridine is Cc1nn(Cc2c(F)cncc2F)c2ncc(F)cc12.
What is the InChIKey of 1-[(3,5-difluoro-4-pyridinyl)methyl]-5-fluoro-3-methylpyrazolo[5,4-b]pyridine?
The InChIKey is ZJCVGOTWZUXVIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9F3N4/c1-7-9-2-8(14)3-18-13(9)20(19-7)6-10-11(15)4-17-5-12(10)16/h2-5H,6H2,1H3.
What are the key properties of 1-[(3,5-difluoro-4-pyridinyl)methyl]-5-fluoro-3-methylpyrazolo[5,4-b]pyridine?
1-[(3,5-difluoro-4-pyridinyl)methyl]-5-fluoro-3-methylpyrazolo[5,4-b]pyridine has a molecular weight of 278.24 g/mol, XLogP of 2.60, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-difluoro-4-pyridinyl)methyl]-5-fluoro-3-methylpyrazolo[5,4-b]pyridine is sourced from PubChem (CID 130348871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).