C13H22BrNOS — CID 130349172
(2Z,4Z)-6-bromo-4-(2,2-dimethyl-1-oxothian-4-yl)hexa-2,4-dien-1-amine (PubChem CID 130349172) has the molecular formula C13H22BrNOS and a molecular weight of 320.30 g/mol. Its IUPAC name is (2Z,4Z)-6-bromo-4-(2,2-dimethyl-1-oxothian-4-yl)hexa-2,4-dien-1-amine.
| Compound Name | (2Z,4Z)-6-bromo-4-(2,2-dimethyl-1-oxothian-4-yl)hexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 130349172 |
| Molecular Formula | C13H22BrNOS |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | (2Z,4Z)-6-bromo-4-(2,2-dimethyl-1-oxothian-4-yl)hexa-2,4-dien-1-amine |
| SMILES | CC1(C)CC(C(/C=C\CN)=C/CBr)CCS1=O |
| InChI | InChI=1S/C13H22BrNOS/c1-13(2)10-12(6-9-17(13)16)11(5-7-14)4-3-8-15/h3-5,12H,6-10,15H2,1-2H3/b4-3-,11-5+ |
| InChIKey | RTBCXQBUCOVSGL-LDTZZKCISA-N |
| XLogP | 2.76 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|