C43H52N2 — CID 130349177
9-[6-(1,2,5,6,10,10a-hexahydrophenanthren-9-yl)-2-(4-cyclohexa-2,4-dien-1-ylcyclohexen-1-yl)-3,4-dihydropyridin-4-yl]-1,2,3,4,4a,5,6,7,8,9a-decahydrocarbazole (PubChem CID 130349177) has the molecular formula C43H52N2 and a molecular weight of 596.90 g/mol. Its IUPAC name is 9-[6-(1,2,5,6,10,10a-hexahydrophenanthren-9-yl)-2-(4-cyclohexa-2,4-dien-1-ylcyclohexen-1-yl)-3,4-dihydropyridin-4-yl]-1,2,3,4,4a,5,6,7,8,9a-decahydrocarbazole.
| Compound Name | 9-[6-(1,2,5,6,10,10a-hexahydrophenanthren-9-yl)-2-(4-cyclohexa-2,4-dien-1-ylcyclohexen-1-yl)-3,4-dihydropyridin-4-yl]-1,2,3,4,4a,5,6,7,8,9a-decahydrocarbazole |
|---|---|
| PubChem CID | 130349177 |
| Molecular Formula | C43H52N2 |
| Molecular Weight | 596.90 g/mol |
| Exact Mass | 596.41 |
| IUPAC Name | 9-[6-(1,2,5,6,10,10a-hexahydrophenanthren-9-yl)-2-(4-cyclohexa-2,4-dien-1-ylcyclohexen-1-yl)-3,4-dihydropyridin-4-yl]-1,2,3,4,4a,5,6,7,8,9a-decahydrocarbazole |
| SMILES | C1=CCC(C2CC=C(C3=NC(C4=C5C=CCCC5=C5C=CCCC5C4)=CC(N4C5=C(CCCC5)C5CCCCC54)C3)CC2)C=C1 |
| InChI | InChI=1S/C43H52N2/c1-2-12-29(13-3-1)30-22-24-31(25-23-30)40-27-33(45-42-20-10-8-18-37(42)38-19-9-11-21-43(38)45)28-41(44-40)39-26-32-14-4-5-15-34(32)35-16-6-7-17-36(35)39/h1-3,5,7,12,15,17,24,28-30,32-33,37,42H,4,6,8-11,13-14,16,18-23,25-27H2 |
| InChIKey | JBGHQLSWGDVPNN-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.90 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |