About (12Z,15Z)-1-(dimethylamino)henicosa-12,15-dien-2-ol
(12Z,15Z)-1-(dimethylamino)henicosa-12,15-dien-2-ol (PubChem CID 130349194) has the molecular formula C23H45NO
and a molecular weight of 351.62 g/mol. Its IUPAC name is (12Z,15Z)-1-(dimethylamino)henicosa-12,15-dien-2-ol.
Molecular Properties
| Compound Name | (12Z,15Z)-1-(dimethylamino)henicosa-12,15-dien-2-ol |
| PubChem CID | 130349194 |
| Molecular Formula | C23H45NO |
| Molecular Weight | 351.62 g/mol |
| Exact Mass | 351.35 |
| IUPAC Name | (12Z,15Z)-1-(dimethylamino)henicosa-12,15-dien-2-ol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(O)CN(C)C |
| InChI | InChI=1S/C23H45NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23(25)22-24(2)3/h8-9,11-12,23,25H,4-7,10,13-22H2,1-3H3/b9-8-,12-11- |
| InChIKey | MZCZDKFOYXHLRG-MURFETPASA-N |
| XLogP | 6.50 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.62 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (12Z,15Z)-1-(dimethylamino)henicosa-12,15-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (12Z,15Z)-1-(dimethylamino)henicosa-12,15-dien-2-ol?
The IUPAC name of (12Z,15Z)-1-(dimethylamino)henicosa-12,15-dien-2-ol (CID 130349194) is (12Z,15Z)-1-(dimethylamino)henicosa-12,15-dien-2-ol.
What is the SMILES notation for (12Z,15Z)-1-(dimethylamino)henicosa-12,15-dien-2-ol?
The canonical SMILES for (12Z,15Z)-1-(dimethylamino)henicosa-12,15-dien-2-ol is CCCCC/C=C\C/C=C\CCCCCCCCCC(O)CN(C)C.
What is the InChIKey of (12Z,15Z)-1-(dimethylamino)henicosa-12,15-dien-2-ol?
The InChIKey is MZCZDKFOYXHLRG-MURFETPASA-N. The full InChI is InChI=1S/C23H45NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23(25)22-24(2)3/h8-9,11-12,23,25H,4-7,10,13-22H2,1-3H3/b9-8-,12-11-.
What are the key properties of (12Z,15Z)-1-(dimethylamino)henicosa-12,15-dien-2-ol?
(12Z,15Z)-1-(dimethylamino)henicosa-12,15-dien-2-ol has a molecular weight of 351.62 g/mol, XLogP of 6.50, 18 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (12Z,15Z)-1-(dimethylamino)henicosa-12,15-dien-2-ol is sourced from PubChem (CID 130349194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).