C21H34FIO4 — CID 13034922
(5R)-5-[(2R,3aR,4S,5R,6aS)-4-[(E,3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoic acid (PubChem CID 13034922) has the molecular formula C21H34FIO4 and a molecular weight of 496.40 g/mol. Its IUPAC name is (5R)-5-[(2R,3aR,4S,5R,6aS)-4-[(E,3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoic acid.
| Compound Name | (5R)-5-[(2R,3aR,4S,5R,6aS)-4-[(E,3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoic acid |
|---|---|
| PubChem CID | 13034922 |
| Molecular Formula | C21H34FIO4 |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | (5R)-5-[(2R,3aR,4S,5R,6aS)-4-[(E,3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoic acid |
| SMILES | CCCC[C@@H](F)[C@H](O)/C=C/[C@H]1[C@H]2C[C@H]([C@H](I)CCCC(=O)O)O[C@H]2C[C@H]1C |
| InChI | InChI=1S/C21H34FIO4/c1-3-4-6-16(22)18(24)10-9-14-13(2)11-19-15(14)12-20(27-19)17(23)7-5-8-21(25)26/h9-10,13-20,24H,3-8,11-12H2,1-2H3,(H,25,26)/b10-9+/t13-,14-,15-,16-,17-,18-,19+,20-/m1/s1 |
| InChIKey | XKXZETDRIWEROB-DHQRHQGRSA-N |
| XLogP | 4.92 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|