C19H33N — CID 130349241
1-(3-cyclohexylcyclopentyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole (PubChem CID 130349241) has the molecular formula C19H33N and a molecular weight of 275.48 g/mol. Its IUPAC name is 1-(3-cyclohexylcyclopentyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole.
| Compound Name | 1-(3-cyclohexylcyclopentyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole |
|---|---|
| PubChem CID | 130349241 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | 1-(3-cyclohexylcyclopentyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole |
| SMILES | C1CCC(C2CCC(C3NCC4CCCCC43)C2)CC1 |
| InChI | InChI=1S/C19H33N/c1-2-6-14(7-3-1)15-10-11-16(12-15)19-18-9-5-4-8-17(18)13-20-19/h14-20H,1-13H2 |
| InChIKey | MODMFUNAWXKBPA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |