C34H44N2 — CID 130349282
(2S)-4-(1,2,4a,5,6,7,8,9,10,12a-decahydrochrysen-6-yl)-6-(cyclohexen-1-yl)-2-cyclohex-3-en-1-yl-1,2,3,4-tetrahydropyrimidine (PubChem CID 130349282) has the molecular formula C34H44N2 and a molecular weight of 480.74 g/mol. Its IUPAC name is (2S)-4-(1,2,4a,5,6,7,8,9,10,12a-decahydrochrysen-6-yl)-6-(cyclohexen-1-yl)-2-cyclohex-3-en-1-yl-1,2,3,4-tetrahydropyrimidine.
| Compound Name | (2S)-4-(1,2,4a,5,6,7,8,9,10,12a-decahydrochrysen-6-yl)-6-(cyclohexen-1-yl)-2-cyclohex-3-en-1-yl-1,2,3,4-tetrahydropyrimidine |
|---|---|
| PubChem CID | 130349282 |
| Molecular Formula | C34H44N2 |
| Molecular Weight | 480.74 g/mol |
| Exact Mass | 480.35 |
| IUPAC Name | (2S)-4-(1,2,4a,5,6,7,8,9,10,12a-decahydrochrysen-6-yl)-6-(cyclohexen-1-yl)-2-cyclohex-3-en-1-yl-1,2,3,4-tetrahydropyrimidine |
| SMILES | C1=CC2C3=C(C=CC2CC1)C1=C(CCCC1)C(C1C=C(C2=CCCCC2)N[C@@H](C2CC=CCC2)N1)C3 |
| InChI | InChI=1S/C34H44N2/c1-3-12-24(13-4-1)32-22-33(36-34(35-32)25-14-5-2-6-15-25)31-21-30-26-16-8-7-11-23(26)19-20-29(30)27-17-9-10-18-28(27)31/h2,5,8,12,16,19-20,22-23,25-26,31,33-36H,1,3-4,6-7,9-11,13-15,17-18,21H2/t23?,25?,26?,31?,33?,34-/m1/s1 |
| InChIKey | JCAOESFRWJSLSL-SWHVAHBMSA-N |
| XLogP | 7.95 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.74 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|