C39H51N — CID 130349310
N-(3,4,4a,5,6,8a-hexahydronaphthalen-2-ylmethyl)-1-[5-cyclohex-3-en-1-yl-3-(9,9-dimethyl-1,4,4a,7,8,9a-hexahydrofluoren-1-yl)cyclohexen-1-yl]methanimine (PubChem CID 130349310) has the molecular formula C39H51N and a molecular weight of 533.84 g/mol. Its IUPAC name is N-(3,4,4a,5,6,8a-hexahydronaphthalen-2-ylmethyl)-1-[5-cyclohex-3-en-1-yl-3-(9,9-dimethyl-1,4,4a,7,8,9a-hexahydrofluoren-1-yl)cyclohexen-1-yl]methanimine.
| Compound Name | N-(3,4,4a,5,6,8a-hexahydronaphthalen-2-ylmethyl)-1-[5-cyclohex-3-en-1-yl-3-(9,9-dimethyl-1,4,4a,7,8,9a-hexahydrofluoren-1-yl)cyclohexen-1-yl]methanimine |
|---|---|
| PubChem CID | 130349310 |
| Molecular Formula | C39H51N |
| Molecular Weight | 533.84 g/mol |
| Exact Mass | 533.40 |
| IUPAC Name | N-(3,4,4a,5,6,8a-hexahydronaphthalen-2-ylmethyl)-1-[5-cyclohex-3-en-1-yl-3-(9,9-dimethyl-1,4,4a,7,8,9a-hexahydrofluoren-1-yl)cyclohexen-1-yl]methanimine |
| SMILES | CC1(C)C2=C(C=CCC2)C2CC=CC(C3C=C(/C=N/CC4=CC5C=CCCC5CC4)CC(C4CC=CCC4)C3)C21 |
| InChI | InChI=1S/C39H51N/c1-39(2)37-18-9-8-15-35(37)36-17-10-16-34(38(36)39)33-23-28(22-32(24-33)29-11-4-3-5-12-29)26-40-25-27-19-20-30-13-6-7-14-31(30)21-27/h3-4,7-8,10,14-16,21,23,26,29-34,36,38H,5-6,9,11-13,17-20,22,24-25H2,1-2H3/b40-26+ |
| InChIKey | XTBNQXKYFCYLCV-IHELAITMSA-N |
| XLogP | 10.16 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.84 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|