C28H34N4O3 — CID 130349321
5-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[(1R,5S,6R)-6-hydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-3-yl]phenyl]-1H-imidazole-2-carboxamide (PubChem CID 130349321) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is 5-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[(1R,5S,6R)-6-hydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-3-yl]phenyl]-1H-imidazole-2-carboxamide.
| Compound Name | 5-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[(1R,5S,6R)-6-hydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-3-yl]phenyl]-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 130349321 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 5-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[(1R,5S,6R)-6-hydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-3-yl]phenyl]-1H-imidazole-2-carboxamide |
| SMILES | CC1(C)CC=C(c2cc(C3C[C@]4(C)C[C@@H](O)[C@](C)(C3)O4)ccc2NC(=O)c2ncc(C#N)[nH]2)CC1 |
| InChI | InChI=1S/C28H34N4O3/c1-26(2)9-7-17(8-10-26)21-11-18(19-12-27(3)14-23(33)28(4,13-19)35-27)5-6-22(21)32-25(34)24-30-16-20(15-29)31-24/h5-7,11,16,19,23,33H,8-10,12-14H2,1-4H3,(H,30,31)(H,32,34)/t19?,23-,27-,28+/m1/s1 |
| InChIKey | XTUWPPPTQZSSCS-YJYDUXCUSA-N |
| XLogP | 5.30 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |