C29H39N3O4 — CID 130349447
N-[4-[(1S,3S,5R,6S,7R)-3,6-dihydroxy-1,5,7-trimethyl-8-oxabicyclo[3.2.1]octan-3-yl]-2-(4,4-dimethylcyclohexen-1-yl)phenyl]-5-methyl-1H-imidazole-2-carboxamide (PubChem CID 130349447) has the molecular formula C29H39N3O4 and a molecular weight of 493.65 g/mol. Its IUPAC name is N-[4-[(1S,3S,5R,6S,7R)-3,6-dihydroxy-1,5,7-trimethyl-8-oxabicyclo[3.2.1]octan-3-yl]-2-(4,4-dimethylcyclohexen-1-yl)phenyl]-5-methyl-1H-imidazole-2-carboxamide.
| Compound Name | N-[4-[(1S,3S,5R,6S,7R)-3,6-dihydroxy-1,5,7-trimethyl-8-oxabicyclo[3.2.1]octan-3-yl]-2-(4,4-dimethylcyclohexen-1-yl)phenyl]-5-methyl-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 130349447 |
| Molecular Formula | C29H39N3O4 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | N-[4-[(1S,3S,5R,6S,7R)-3,6-dihydroxy-1,5,7-trimethyl-8-oxabicyclo[3.2.1]octan-3-yl]-2-(4,4-dimethylcyclohexen-1-yl)phenyl]-5-methyl-1H-imidazole-2-carboxamide |
| SMILES | Cc1cnc(C(=O)Nc2ccc([C@@]3(O)C[C@@]4(C)O[C@@](C)(C3)[C@H](C)[C@@H]4O)cc2C2=CCC(C)(C)CC2)[nH]1 |
| InChI | InChI=1S/C29H39N3O4/c1-17-14-30-24(31-17)25(34)32-22-8-7-20(13-21(22)19-9-11-26(3,4)12-10-19)29(35)15-27(5)18(2)23(33)28(6,16-29)36-27/h7-9,13-14,18,23,33,35H,10-12,15-16H2,1-6H3,(H,30,31)(H,32,34)/t18-,23+,27+,28-,29+/m1/s1 |
| InChIKey | HLDQLFBYNUEQCV-UGWXCAJUSA-N |
| XLogP | 5.09 |
| TPSA | 107.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |