C19H26N2O — CID 130349520
N'-(2-ethylbutyl)-1,2,4a,9b-tetrahydrodibenzofuran-2-carboximidamide (PubChem CID 130349520) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is N'-(2-ethylbutyl)-1,2,4a,9b-tetrahydrodibenzofuran-2-carboximidamide.
| Compound Name | N'-(2-ethylbutyl)-1,2,4a,9b-tetrahydrodibenzofuran-2-carboximidamide |
|---|---|
| PubChem CID | 130349520 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | N'-(2-ethylbutyl)-1,2,4a,9b-tetrahydrodibenzofuran-2-carboximidamide |
| SMILES | CCC(CC)C/N=C(\N)C1C=CC2Oc3ccccc3C2C1 |
| InChI | InChI=1S/C19H26N2O/c1-3-13(4-2)12-21-19(20)14-9-10-18-16(11-14)15-7-5-6-8-17(15)22-18/h5-10,13-14,16,18H,3-4,11-12H2,1-2H3,(H2,20,21) |
| InChIKey | MYDJFVIUGIOIKP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|