About 3,5-dimethyl-2-[(3Z)-penta-1,3-dien-3-yl]pyridine
3,5-dimethyl-2-[(3Z)-penta-1,3-dien-3-yl]pyridine (PubChem CID 130349544) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is 3,5-dimethyl-2-[(3Z)-penta-1,3-dien-3-yl]pyridine.
Molecular Properties
| Compound Name | 3,5-dimethyl-2-[(3Z)-penta-1,3-dien-3-yl]pyridine |
| PubChem CID | 130349544 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 3,5-dimethyl-2-[(3Z)-penta-1,3-dien-3-yl]pyridine |
| SMILES | C=C/C(=C/C)c1ncc(C)cc1C |
| InChI | InChI=1S/C12H15N/c1-5-11(6-2)12-10(4)7-9(3)8-13-12/h5-8H,1H2,2-4H3/b11-6- |
| InChIKey | FLUNYYMPRZCTTP-WDZFZDKYSA-N |
| XLogP | 3.29 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-2-[(3Z)-penta-1,3-dien-3-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-2-[(3Z)-penta-1,3-dien-3-yl]pyridine?
The IUPAC name of 3,5-dimethyl-2-[(3Z)-penta-1,3-dien-3-yl]pyridine (CID 130349544) is 3,5-dimethyl-2-[(3Z)-penta-1,3-dien-3-yl]pyridine.
What is the SMILES notation for 3,5-dimethyl-2-[(3Z)-penta-1,3-dien-3-yl]pyridine?
The canonical SMILES for 3,5-dimethyl-2-[(3Z)-penta-1,3-dien-3-yl]pyridine is C=C/C(=C/C)c1ncc(C)cc1C.
What is the InChIKey of 3,5-dimethyl-2-[(3Z)-penta-1,3-dien-3-yl]pyridine?
The InChIKey is FLUNYYMPRZCTTP-WDZFZDKYSA-N. The full InChI is InChI=1S/C12H15N/c1-5-11(6-2)12-10(4)7-9(3)8-13-12/h5-8H,1H2,2-4H3/b11-6-.
What are the key properties of 3,5-dimethyl-2-[(3Z)-penta-1,3-dien-3-yl]pyridine?
3,5-dimethyl-2-[(3Z)-penta-1,3-dien-3-yl]pyridine has a molecular weight of 173.26 g/mol, XLogP of 3.29, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-2-[(3Z)-penta-1,3-dien-3-yl]pyridine is sourced from PubChem (CID 130349544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).