C15H25NO2S — CID 130349602
(3Z,5Z)-N-cyclohexyl-N,5-dimethylhepta-1,3,5-triene-2-sulfonamide (PubChem CID 130349602) has the molecular formula C15H25NO2S and a molecular weight of 283.44 g/mol. Its IUPAC name is (3Z,5Z)-N-cyclohexyl-N,5-dimethylhepta-1,3,5-triene-2-sulfonamide.
| Compound Name | (3Z,5Z)-N-cyclohexyl-N,5-dimethylhepta-1,3,5-triene-2-sulfonamide |
|---|---|
| PubChem CID | 130349602 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (3Z,5Z)-N-cyclohexyl-N,5-dimethylhepta-1,3,5-triene-2-sulfonamide |
| SMILES | C=C(/C=C\C(C)=C/C)S(=O)(=O)N(C)C1CCCCC1 |
| InChI | InChI=1S/C15H25NO2S/c1-5-13(2)11-12-14(3)19(17,18)16(4)15-9-7-6-8-10-15/h5,11-12,15H,3,6-10H2,1-2,4H3/b12-11-,13-5- |
| InChIKey | XYLXJLLQQBYZTP-KVXUBGLVSA-N |
| XLogP | 3.62 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|