About tert-butyl N-[(3Z)-5-chloro-4-fluoro-1-hydroxy-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]carbamate
tert-butyl N-[(3Z)-5-chloro-4-fluoro-1-hydroxy-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]carbamate (PubChem CID 130349769) has the molecular formula C14H21ClFNO3
and a molecular weight of 305.78 g/mol. Its IUPAC name is tert-butyl N-[(3Z)-5-chloro-4-fluoro-1-hydroxy-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(3Z)-5-chloro-4-fluoro-1-hydroxy-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]carbamate |
| PubChem CID | 130349769 |
| Molecular Formula | C14H21ClFNO3 |
| Molecular Weight | 305.78 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | tert-butyl N-[(3Z)-5-chloro-4-fluoro-1-hydroxy-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]carbamate |
| SMILES | C=C(Cl)/C(F)=C(\C=C/C)C(CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H21ClFNO3/c1-6-7-10(12(16)9(2)15)11(8-18)17-13(19)20-14(3,4)5/h6-7,11,18H,2,8H2,1,3-5H3,(H,17,19)/b7-6-,12-10- |
| InChIKey | ZEEJMIJIWZDIOZ-CEHXRRPISA-N |
| XLogP | 3.42 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.78 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(3Z)-5-chloro-4-fluoro-1-hydroxy-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(3Z)-5-chloro-4-fluoro-1-hydroxy-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]carbamate?
The IUPAC name of tert-butyl N-[(3Z)-5-chloro-4-fluoro-1-hydroxy-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]carbamate (CID 130349769) is tert-butyl N-[(3Z)-5-chloro-4-fluoro-1-hydroxy-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(3Z)-5-chloro-4-fluoro-1-hydroxy-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[(3Z)-5-chloro-4-fluoro-1-hydroxy-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]carbamate is C=C(Cl)/C(F)=C(\C=C/C)C(CO)NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(3Z)-5-chloro-4-fluoro-1-hydroxy-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]carbamate?
The InChIKey is ZEEJMIJIWZDIOZ-CEHXRRPISA-N. The full InChI is InChI=1S/C14H21ClFNO3/c1-6-7-10(12(16)9(2)15)11(8-18)17-13(19)20-14(3,4)5/h6-7,11,18H,2,8H2,1,3-5H3,(H,17,19)/b7-6-,12-10-.
What are the key properties of tert-butyl N-[(3Z)-5-chloro-4-fluoro-1-hydroxy-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]carbamate?
tert-butyl N-[(3Z)-5-chloro-4-fluoro-1-hydroxy-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]carbamate has a molecular weight of 305.78 g/mol, XLogP of 3.42, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(3Z)-5-chloro-4-fluoro-1-hydroxy-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]carbamate is sourced from PubChem (CID 130349769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).