About 8-methyl-4,8-dihydrocyclohepta[d][1,3]dioxine
8-methyl-4,8-dihydrocyclohepta[d][1,3]dioxine (PubChem CID 130349835) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is 8-methyl-4,8-dihydrocyclohepta[d][1,3]dioxine.
Molecular Properties
| Compound Name | 8-methyl-4,8-dihydrocyclohepta[d][1,3]dioxine |
| PubChem CID | 130349835 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 8-methyl-4,8-dihydrocyclohepta[d][1,3]dioxine |
| SMILES | CC1C=CC=C2COCOC2=C1 |
| InChI | InChI=1S/C10H12O2/c1-8-3-2-4-9-6-11-7-12-10(9)5-8/h2-5,8H,6-7H2,1H3 |
| InChIKey | MMFLIYDGSPRDCK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-methyl-4,8-dihydrocyclohepta[d][1,3]dioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-4,8-dihydrocyclohepta[d][1,3]dioxine?
The IUPAC name of 8-methyl-4,8-dihydrocyclohepta[d][1,3]dioxine (CID 130349835) is 8-methyl-4,8-dihydrocyclohepta[d][1,3]dioxine.
What is the SMILES notation for 8-methyl-4,8-dihydrocyclohepta[d][1,3]dioxine?
The canonical SMILES for 8-methyl-4,8-dihydrocyclohepta[d][1,3]dioxine is CC1C=CC=C2COCOC2=C1.
What is the InChIKey of 8-methyl-4,8-dihydrocyclohepta[d][1,3]dioxine?
The InChIKey is MMFLIYDGSPRDCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c1-8-3-2-4-9-6-11-7-12-10(9)5-8/h2-5,8H,6-7H2,1H3.
What are the key properties of 8-methyl-4,8-dihydrocyclohepta[d][1,3]dioxine?
8-methyl-4,8-dihydrocyclohepta[d][1,3]dioxine has a molecular weight of 164.20 g/mol, XLogP of 2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-4,8-dihydrocyclohepta[d][1,3]dioxine is sourced from PubChem (CID 130349835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).