C9H12N2 — CID 130349886
7-methyl-1,2,8,8a-tetrahydroquinoxaline (PubChem CID 130349886) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 7-methyl-1,2,8,8a-tetrahydroquinoxaline.
| Compound Name | 7-methyl-1,2,8,8a-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 130349886 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 7-methyl-1,2,8,8a-tetrahydroquinoxaline |
| SMILES | CC1=CC=C2N=CCNC2C1 |
| InChI | InChI=1S/C9H12N2/c1-7-2-3-8-9(6-7)11-5-4-10-8/h2-4,9,11H,5-6H2,1H3 |
| InChIKey | XYNAVBRQRYXKQE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |