C7H12N2 — CID 130350099
5-ethenyl-2-methyl-1,4,5,6-tetrahydropyrimidine (PubChem CID 130350099) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is 5-ethenyl-2-methyl-1,4,5,6-tetrahydropyrimidine.
| Compound Name | 5-ethenyl-2-methyl-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 130350099 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 5-ethenyl-2-methyl-1,4,5,6-tetrahydropyrimidine |
| SMILES | C=CC1CN=C(C)NC1 |
| InChI | InChI=1S/C7H12N2/c1-3-7-4-8-6(2)9-5-7/h3,7H,1,4-5H2,2H3,(H,8,9) |
| InChIKey | MDGMLCFNZRVGJV-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|