C24H28N2S — CID 130350375
1-(4,5-dimethyl-1,3-thiazol-2-yl)-N-[2,6-di(propan-2-yl)phenyl]-1-phenylmethanimine (PubChem CID 130350375) has the molecular formula C24H28N2S and a molecular weight of 376.57 g/mol. Its IUPAC name is 1-(4,5-dimethyl-1,3-thiazol-2-yl)-N-[2,6-di(propan-2-yl)phenyl]-1-phenylmethanimine.
| Compound Name | 1-(4,5-dimethyl-1,3-thiazol-2-yl)-N-[2,6-di(propan-2-yl)phenyl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 130350375 |
| Molecular Formula | C24H28N2S |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 1-(4,5-dimethyl-1,3-thiazol-2-yl)-N-[2,6-di(propan-2-yl)phenyl]-1-phenylmethanimine |
| SMILES | Cc1nc(/C(=N\c2c(C(C)C)cccc2C(C)C)c2ccccc2)sc1C |
| InChI | InChI=1S/C24H28N2S/c1-15(2)20-13-10-14-21(16(3)4)23(20)26-22(19-11-8-7-9-12-19)24-25-17(5)18(6)27-24/h7-16H,1-6H3/b26-22- |
| InChIKey | VXFKRVNNIPCNHG-ROMGYVFFSA-N |
| XLogP | 7.18 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|