C23H45N3O — CID 130350538
(3Z,5Z)-5-[[bis[3-(dimethylamino)propyl]amino]methyl]-2,2,3,7-tetramethylocta-3,5,7-trien-4-ol (PubChem CID 130350538) has the molecular formula C23H45N3O and a molecular weight of 379.63 g/mol. Its IUPAC name is (3Z,5Z)-5-[[bis[3-(dimethylamino)propyl]amino]methyl]-2,2,3,7-tetramethylocta-3,5,7-trien-4-ol.
| Compound Name | (3Z,5Z)-5-[[bis[3-(dimethylamino)propyl]amino]methyl]-2,2,3,7-tetramethylocta-3,5,7-trien-4-ol |
|---|---|
| PubChem CID | 130350538 |
| Molecular Formula | C23H45N3O |
| Molecular Weight | 379.63 g/mol |
| Exact Mass | 379.36 |
| IUPAC Name | (3Z,5Z)-5-[[bis[3-(dimethylamino)propyl]amino]methyl]-2,2,3,7-tetramethylocta-3,5,7-trien-4-ol |
| SMILES | C=C(C)/C=C(CN(CCCN(C)C)CCCN(C)C)\C(O)=C(/C)C(C)(C)C |
| InChI | InChI=1S/C23H45N3O/c1-19(2)17-21(22(27)20(3)23(4,5)6)18-26(15-11-13-24(7)8)16-12-14-25(9)10/h17,27H,1,11-16,18H2,2-10H3/b21-17-,22-20- |
| InChIKey | OAGXXVQKDMJGMD-VXTJRRPDSA-N |
| XLogP | 4.57 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.63 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|