C41H76N2O2 — CID 130350620
2-(dimethylamino)ethyl N-[(6E,8Z,27Z,30Z)-hexatriaconta-6,8,27,30-tetraen-18-yl]carbamate (PubChem CID 130350620) has the molecular formula C41H76N2O2 and a molecular weight of 629.07 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl N-[(6E,8Z,27Z,30Z)-hexatriaconta-6,8,27,30-tetraen-18-yl]carbamate.
| Compound Name | 2-(dimethylamino)ethyl N-[(6E,8Z,27Z,30Z)-hexatriaconta-6,8,27,30-tetraen-18-yl]carbamate |
|---|---|
| PubChem CID | 130350620 |
| Molecular Formula | C41H76N2O2 |
| Molecular Weight | 629.07 g/mol |
| Exact Mass | 628.59 |
| IUPAC Name | 2-(dimethylamino)ethyl N-[(6E,8Z,27Z,30Z)-hexatriaconta-6,8,27,30-tetraen-18-yl]carbamate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C=C\CCCCC)NC(=O)OCCN(C)C |
| InChI | InChI=1S/C41H76N2O2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-40(42-41(44)45-39-38-43(3)4)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,18-21,40H,5-12,17,22-39H2,1-4H3,(H,42,44)/b15-13-,16-14+,20-18-,21-19- |
| InChIKey | FQBWLTYWCCZBGQ-ADMWARDPSA-N |
| XLogP | 12.66 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.07 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|