C8H15N3 — CID 130350695
(1Z,3E)-4-(ethylideneamino)-3-methylpenta-1,3-diene-1,5-diamine (PubChem CID 130350695) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is (1Z,3E)-4-(ethylideneamino)-3-methylpenta-1,3-diene-1,5-diamine.
| Compound Name | (1Z,3E)-4-(ethylideneamino)-3-methylpenta-1,3-diene-1,5-diamine |
|---|---|
| PubChem CID | 130350695 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | (1Z,3E)-4-(ethylideneamino)-3-methylpenta-1,3-diene-1,5-diamine |
| SMILES | C/C=N/C(CN)=C(C)/C=C\N |
| InChI | InChI=1S/C8H15N3/c1-3-11-8(6-10)7(2)4-5-9/h3-5H,6,9-10H2,1-2H3/b5-4-,8-7+,11-3+ |
| InChIKey | LRIWXRVPWUBJCZ-SFJJQLNNSA-N |
| XLogP | 0.78 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|