C11H24O3S — CID 130350882
1-methoxy-2,2,4,4-tetramethyl-5-methylsulfonylpentane (PubChem CID 130350882) has the molecular formula C11H24O3S and a molecular weight of 236.38 g/mol. Its IUPAC name is 1-methoxy-2,2,4,4-tetramethyl-5-methylsulfonylpentane.
| Compound Name | 1-methoxy-2,2,4,4-tetramethyl-5-methylsulfonylpentane |
|---|---|
| PubChem CID | 130350882 |
| Molecular Formula | C11H24O3S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 1-methoxy-2,2,4,4-tetramethyl-5-methylsulfonylpentane |
| SMILES | COCC(C)(C)CC(C)(C)CS(C)(=O)=O |
| InChI | InChI=1S/C11H24O3S/c1-10(2,8-14-5)7-11(3,4)9-15(6,12)13/h7-9H2,1-6H3 |
| InChIKey | QCZNSACSRDJKFL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |